C18H25F2N5 — CID 111901447
1-[(2,5-difluorophenyl)methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methylguanidine (PubChem CID 111901447) has the molecular formula C18H25F2N5 and a molecular weight of 349.43 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methylguanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111901447 |
| Molecular Formula | C18H25F2N5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1cc(F)ccc1F)NCC(C)Cn1nc(C)cc1C |
| InChI | InChI=1S/C18H25F2N5/c1-12(11-25-14(3)7-13(2)24-25)9-22-18(21-4)23-10-15-8-16(19)5-6-17(15)20/h5-8,12H,9-11H2,1-4H3,(H2,21,22,23) |
| InChIKey | XLPWRXBKXVEJJA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|