C18H25F3IN5S2 — CID 111616530
2-methyl-1-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111616530) has the molecular formula C18H25F3IN5S2 and a molecular weight of 559.47 g/mol. Its IUPAC name is 2-methyl-1-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111616530 |
| Molecular Formula | C18H25F3IN5S2 |
| Molecular Weight | 559.47 g/mol |
| Exact Mass | 559.05 |
| IUPAC Name | 2-methyl-1-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nc(C(F)(F)F)cs1)NCC1CCCN(Cc2cccs2)C1.I |
| InChI | InChI=1S/C18H24F3N5S2.HI/c1-22-17(24-9-16-25-15(12-28-16)18(19,20)21)23-8-13-4-2-6-26(10-13)11-14-5-3-7-27-14;/h3,5,7,12-13H,2,4,6,8-11H2,1H3,(H2,22,23,24);1H |
| InChIKey | AKPAGTPPYWNBIW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|