C18H37IN6O — CID 111621163
2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-[2-[di(propan-2-yl)amino]ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111621163) has the molecular formula C18H37IN6O and a molecular weight of 480.44 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-[2-[di(propan-2-yl)amino]ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-[2-[di(propan-2-yl)amino]ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111621163 |
| Molecular Formula | C18H37IN6O |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-[2-[di(propan-2-yl)amino]ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1noc(C(C)(C)C)n1)NCCN(C(C)C)C(C)C.I |
| InChI | InChI=1S/C18H36N6O.HI/c1-9-19-17(20-10-11-24(13(2)3)14(4)5)21-12-15-22-16(25-23-15)18(6,7)8;/h13-14H,9-12H2,1-8H3,(H2,19,20,21);1H |
| InChIKey | CYVCVRRERNZIFH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|