C18H27ClIN5O — CID 111621385
2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-[2-(3-chlorophenyl)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111621385) has the molecular formula C18H27ClIN5O and a molecular weight of 491.81 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-[2-(3-chlorophenyl)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-[2-(3-chlorophenyl)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111621385 |
| Molecular Formula | C18H27ClIN5O |
| Molecular Weight | 491.81 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-[2-(3-chlorophenyl)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1noc(C(C)(C)C)n1)NCCc1cccc(Cl)c1.I |
| InChI | InChI=1S/C18H26ClN5O.HI/c1-5-20-17(21-10-9-13-7-6-8-14(19)11-13)22-12-15-23-16(25-24-15)18(2,3)4;/h6-8,11H,5,9-10,12H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | ISZLENQPDBJQFD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.81 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|