C22H36ClN3O3 — CID 111624552
1-[(2-tert-butyloxan-3-yl)methyl]-3-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-methylguanidine (PubChem CID 111624552) has the molecular formula C22H36ClN3O3 and a molecular weight of 426.00 g/mol. Its IUPAC name is 1-[(2-tert-butyloxan-3-yl)methyl]-3-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111624552 |
| Molecular Formula | C22H36ClN3O3 |
| Molecular Weight | 426.00 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-methylguanidine |
| SMILES | CCOc1c(Cl)cc(CN/C(=N/C)NCC2CCCOC2C(C)(C)C)cc1OC |
| InChI | InChI=1S/C22H36ClN3O3/c1-7-28-19-17(23)11-15(12-18(19)27-6)13-25-21(24-5)26-14-16-9-8-10-29-20(16)22(2,3)4/h11-12,16,20H,7-10,13-14H2,1-6H3,(H2,24,25,26) |
| InChIKey | IPJRJZHHCFOEDL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.00 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|