C18H27NO4 — CID 11163019
ethyl (E)-4,4-diethoxy-3-[[(1R)-1-phenylethyl]amino]but-2-enoate (PubChem CID 11163019) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is ethyl (E)-4,4-diethoxy-3-[[(1R)-1-phenylethyl]amino]but-2-enoate.
| Compound Name | ethyl (E)-4,4-diethoxy-3-[[(1R)-1-phenylethyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 11163019 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | ethyl (E)-4,4-diethoxy-3-[[(1R)-1-phenylethyl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(/N[C@H](C)c1ccccc1)C(OCC)OCC |
| InChI | InChI=1S/C18H27NO4/c1-5-21-17(20)13-16(18(22-6-2)23-7-3)19-14(4)15-11-9-8-10-12-15/h8-14,18-19H,5-7H2,1-4H3/b16-13+/t14-/m1/s1 |
| InChIKey | QEGBCZIEZGFUQI-LBFFYKKLSA-N |
| XLogP | 3.18 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|