C17H24N2O3 — CID 111630644
1-(3,4-dihydro-2H-chromen-3-yl)-3-[2-(hydroxymethyl)cyclohexyl]urea (PubChem CID 111630644) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-3-yl)-3-[2-(hydroxymethyl)cyclohexyl]urea.
| Compound Name | 1-(3,4-dihydro-2H-chromen-3-yl)-3-[2-(hydroxymethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 111630644 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-3-yl)-3-[2-(hydroxymethyl)cyclohexyl]urea |
| SMILES | O=C(NC1COc2ccccc2C1)NC1CCCCC1CO |
| InChI | InChI=1S/C17H24N2O3/c20-10-13-6-1-3-7-15(13)19-17(21)18-14-9-12-5-2-4-8-16(12)22-11-14/h2,4-5,8,13-15,20H,1,3,6-7,9-11H2,(H2,18,19,21) |
| InChIKey | AURQMWJSMFVCMS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |