C14H22N4O2S — CID 111631424
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(5-pentyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 111631424) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(5-pentyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(5-pentyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 111631424 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(5-pentyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCCCCc1nnc(NC(=O)N[C@@H]2C=C[C@H](CO)C2)s1 |
| InChI | InChI=1S/C14H22N4O2S/c1-2-3-4-5-12-17-18-14(21-12)16-13(20)15-11-7-6-10(8-11)9-19/h6-7,10-11,19H,2-5,8-9H2,1H3,(H2,15,16,18,20)/t10-,11+/m0/s1 |
| InChIKey | HXQKVZUSYJONCZ-WDEREUQCSA-N |
| XLogP | 2.33 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|