C21H33IN4O — CID 111631529
3-[2-[[N-[2-(2-bicyclo[2.2.1]heptanyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide (PubChem CID 111631529) has the molecular formula C21H33IN4O and a molecular weight of 484.43 g/mol. Its IUPAC name is 3-[2-[[N-[2-(2-bicyclo[2.2.1]heptanyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[2-[[N-[2-(2-bicyclo[2.2.1]heptanyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111631529 |
| Molecular Formula | C21H33IN4O |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 3-[2-[[N-[2-(2-bicyclo[2.2.1]heptanyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
| SMILES | C/N=C(\NCCc1cccc(C(=O)NC)c1)NCCC1CC2CCC1C2.I |
| InChI | InChI=1S/C21H32N4O.HI/c1-22-20(26)19-5-3-4-15(12-19)8-10-24-21(23-2)25-11-9-18-14-16-6-7-17(18)13-16;/h3-5,12,16-18H,6-11,13-14H2,1-2H3,(H,22,26)(H2,23,24,25);1H |
| InChIKey | DYDLWMAAOFMMSM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|