About (1-azido-3-diethoxyphosphorylpropan-2-yl) 3-chloropropanoate
(1-azido-3-diethoxyphosphorylpropan-2-yl) 3-chloropropanoate (PubChem CID 11163235) has the molecular formula C10H19ClN3O5P
and a molecular weight of 327.71 g/mol. Its IUPAC name is (1-azido-3-diethoxyphosphorylpropan-2-yl) 3-chloropropanoate.
Molecular Properties
| Compound Name | (1-azido-3-diethoxyphosphorylpropan-2-yl) 3-chloropropanoate |
| PubChem CID | 11163235 |
| Molecular Formula | C10H19ClN3O5P |
| Molecular Weight | 327.71 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | (1-azido-3-diethoxyphosphorylpropan-2-yl) 3-chloropropanoate |
| SMILES | CCOP(=O)(CC(CN=[N+]=[N-])OC(=O)CCCl)OCC |
| InChI | InChI=1S/C10H19ClN3O5P/c1-3-17-20(16,18-4-2)8-9(7-13-14-12)19-10(15)5-6-11/h9H,3-8H2,1-2H3 |
| InChIKey | NHPWUVLXLPHESF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.71 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1-azido-3-diethoxyphosphorylpropan-2-yl) 3-chloropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-azido-3-diethoxyphosphorylpropan-2-yl) 3-chloropropanoate?
The IUPAC name of (1-azido-3-diethoxyphosphorylpropan-2-yl) 3-chloropropanoate (CID 11163235) is (1-azido-3-diethoxyphosphorylpropan-2-yl) 3-chloropropanoate.
What is the SMILES notation for (1-azido-3-diethoxyphosphorylpropan-2-yl) 3-chloropropanoate?
The canonical SMILES for (1-azido-3-diethoxyphosphorylpropan-2-yl) 3-chloropropanoate is CCOP(=O)(CC(CN=[N+]=[N-])OC(=O)CCCl)OCC.
What is the InChIKey of (1-azido-3-diethoxyphosphorylpropan-2-yl) 3-chloropropanoate?
The InChIKey is NHPWUVLXLPHESF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19ClN3O5P/c1-3-17-20(16,18-4-2)8-9(7-13-14-12)19-10(15)5-6-11/h9H,3-8H2,1-2H3.
What are the key properties of (1-azido-3-diethoxyphosphorylpropan-2-yl) 3-chloropropanoate?
(1-azido-3-diethoxyphosphorylpropan-2-yl) 3-chloropropanoate has a molecular weight of 327.71 g/mol, XLogP of 3.10, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-azido-3-diethoxyphosphorylpropan-2-yl) 3-chloropropanoate is sourced from PubChem (CID 11163235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).