C20H23NO5 — CID 11164170
tert-butyl 3-ethyl-5-formyl-4-(4-methoxycarbonylphenyl)-1H-pyrrole-2-carboxylate (PubChem CID 11164170) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is tert-butyl 3-ethyl-5-formyl-4-(4-methoxycarbonylphenyl)-1H-pyrrole-2-carboxylate.
| Compound Name | tert-butyl 3-ethyl-5-formyl-4-(4-methoxycarbonylphenyl)-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 11164170 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | tert-butyl 3-ethyl-5-formyl-4-(4-methoxycarbonylphenyl)-1H-pyrrole-2-carboxylate |
| SMILES | CCc1c(C(=O)OC(C)(C)C)[nH]c(C=O)c1-c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C20H23NO5/c1-6-14-16(12-7-9-13(10-8-12)18(23)25-5)15(11-22)21-17(14)19(24)26-20(2,3)4/h7-11,21H,6H2,1-5H3 |
| InChIKey | HQHSAUKPBMCJAT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|