C19H32IN5O4 — CID 111641915
2-methyl-1-[2-(4-nitroanilino)ethyl]-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111641915) has the molecular formula C19H32IN5O4 and a molecular weight of 521.40 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-nitroanilino)ethyl]-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(4-nitroanilino)ethyl]-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111641915 |
| Molecular Formula | C19H32IN5O4 |
| Molecular Weight | 521.40 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 2-methyl-1-[2-(4-nitroanilino)ethyl]-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCOCC1)NCCNc1ccc([N+](=O)[O-])cc1.I |
| InChI | InChI=1S/C19H31N5O4.HI/c1-20-19(22-9-2-12-28-15-16-7-13-27-14-8-16)23-11-10-21-17-3-5-18(6-4-17)24(25)26;/h3-6,16,21H,2,7-15H2,1H3,(H2,20,22,23);1H |
| InChIKey | NGKHOGLTZNBEHH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|