C21H33F2N3O4 — CID 111642064
1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-methyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine (PubChem CID 111642064) has the molecular formula C21H33F2N3O4 and a molecular weight of 429.51 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-methyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine.
| Compound Name | 1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-methyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111642064 |
| Molecular Formula | C21H33F2N3O4 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-methyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine |
| SMILES | CCOc1cc(CN/C(=N/C)NCCCOCC2CCOCC2)ccc1OC(F)F |
| InChI | InChI=1S/C21H33F2N3O4/c1-3-29-19-13-17(5-6-18(19)30-20(22)23)14-26-21(24-2)25-9-4-10-28-15-16-7-11-27-12-8-16/h5-6,13,16,20H,3-4,7-12,14-15H2,1-2H3,(H2,24,25,26) |
| InChIKey | NCWQIEYZNDMXOH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|