C19H33FIN5O2 — CID 111650941
2-[(4-fluorophenyl)methyl]-3-[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111650941) has the molecular formula C19H33FIN5O2 and a molecular weight of 509.41 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-3-[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | 2-[(4-fluorophenyl)methyl]-3-[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111650941 |
| Molecular Formula | C19H33FIN5O2 |
| Molecular Weight | 509.41 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-3-[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(\NCCN(C)CCCOC)NCC(Cc1ccc(F)cc1)C(N)=O.I |
| InChI | InChI=1S/C19H32FN5O2.HI/c1-22-19(23-9-11-25(2)10-4-12-27-3)24-14-16(18(21)26)13-15-5-7-17(20)8-6-15;/h5-8,16H,4,9-14H2,1-3H3,(H2,21,26)(H2,22,23,24);1H |
| InChIKey | IMEZVTKFWMWUDT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|