C19H25IN6OS — CID 111654215
1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111654215) has the molecular formula C19H25IN6OS and a molecular weight of 512.42 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111654215 |
| Molecular Formula | C19H25IN6OS |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nncn1-c1ccccc1)NCC(C)(O)c1ccsc1.I |
| InChI | InChI=1S/C19H24N6OS.HI/c1-3-20-18(22-13-19(2,26)15-9-10-27-12-15)21-11-17-24-23-14-25(17)16-7-5-4-6-8-16;/h4-10,12,14,26H,3,11,13H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | JTGMAUDAPIJDSV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|