C19H32IN5OS — CID 109404230
2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine;hydroiodide (PubChem CID 109404230) has the molecular formula C19H32IN5OS and a molecular weight of 505.47 g/mol. Its IUPAC name is 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109404230 |
| Molecular Formula | C19H32IN5OS |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(CC)nn(C)c1CC)NCC(C)(O)c1ccsc1.I |
| InChI | InChI=1S/C19H31N5OS.HI/c1-6-16-15(17(7-2)24(5)23-16)11-21-18(20-8-3)22-13-19(4,25)14-9-10-26-12-14;/h9-10,12,25H,6-8,11,13H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | KQHIZISWQCXMSE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|