C18H32N4O3S — CID 111654228
tert-butyl N-[2-[[N-ethyl-N'-(2-hydroxy-2-thiophen-3-ylpropyl)carbamimidoyl]amino]ethyl]-N-methylcarbamate (PubChem CID 111654228) has the molecular formula C18H32N4O3S and a molecular weight of 384.55 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-(2-hydroxy-2-thiophen-3-ylpropyl)carbamimidoyl]amino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-(2-hydroxy-2-thiophen-3-ylpropyl)carbamimidoyl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 111654228 |
| Molecular Formula | C18H32N4O3S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-(2-hydroxy-2-thiophen-3-ylpropyl)carbamimidoyl]amino]ethyl]-N-methylcarbamate |
| SMILES | CCN/C(=N\CC(C)(O)c1ccsc1)NCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32N4O3S/c1-7-19-15(21-13-18(5,24)14-8-11-26-12-14)20-9-10-22(6)16(23)25-17(2,3)4/h8,11-12,24H,7,9-10,13H2,1-6H3,(H2,19,20,21) |
| InChIKey | PWYFISLOPXSPPD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|