C20H30IN3O4S — CID 111654487
1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111654487) has the molecular formula C20H30IN3O4S and a molecular weight of 535.45 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111654487 |
| Molecular Formula | C20H30IN3O4S |
| Molecular Weight | 535.45 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1OC)NCC(C)(O)c1ccsc1.I |
| InChI | InChI=1S/C20H29N3O4S.HI/c1-6-21-19(23-13-20(2,24)15-9-10-28-12-15)22-11-14-7-8-16(25-3)18(27-5)17(14)26-4;/h7-10,12,24H,6,11,13H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | QXNKWGQGYJITGH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|