C23H31N3O4S — CID 111655354
1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine (PubChem CID 111655354) has the molecular formula C23H31N3O4S and a molecular weight of 445.59 g/mol. Its IUPAC name is 1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine.
| Compound Name | 1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111655354 |
| Molecular Formula | C23H31N3O4S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccsc1)NCC1(c2ccc3c(c2)OCO3)CCOCC1 |
| InChI | InChI=1S/C23H31N3O4S/c1-3-24-21(25-14-22(2,27)18-6-11-31-13-18)26-15-23(7-9-28-10-8-23)17-4-5-19-20(12-17)30-16-29-19/h4-6,11-13,27H,3,7-10,14-16H2,1-2H3,(H2,24,25,26) |
| InChIKey | WHUUHCYCOPHIGQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|