C23H32IN3O3S — CID 111957688
1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3-ethyl-2-[(5-ethylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111957688) has the molecular formula C23H32IN3O3S and a molecular weight of 557.50 g/mol. Its IUPAC name is 1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3-ethyl-2-[(5-ethylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3-ethyl-2-[(5-ethylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111957688 |
| Molecular Formula | C23H32IN3O3S |
| Molecular Weight | 557.50 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | 1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3-ethyl-2-[(5-ethylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CC)s1)NCC1(c2ccc3c(c2)OCO3)CCOCC1.I |
| InChI | InChI=1S/C23H31N3O3S.HI/c1-3-18-6-7-19(30-18)14-25-22(24-4-2)26-15-23(9-11-27-12-10-23)17-5-8-20-21(13-17)29-16-28-20;/h5-8,13H,3-4,9-12,14-16H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | ZVIPLPIFYKULJN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|