C22H31IN4O2S — CID 111524859
1-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111524859) has the molecular formula C22H31IN4O2S and a molecular weight of 542.49 g/mol. Its IUPAC name is 1-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111524859 |
| Molecular Formula | C22H31IN4O2S |
| Molecular Weight | 542.49 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 1-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCC1(c2ccc3c(c2)OCCO3)CCCC1.I |
| InChI | InChI=1S/C22H30N4O2S.HI/c1-3-23-21(25-14-20-24-13-16(2)29-20)26-15-22(8-4-5-9-22)17-6-7-18-19(12-17)28-11-10-27-18;/h6-7,12-13H,3-5,8-11,14-15H2,1-2H3,(H2,23,25,26);1H |
| InChIKey | IQKXSMZPRPZBSL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|