C14H25IN4O2S — CID 111525111
1-ethyl-3-[(4-hydroxyoxan-4-yl)methyl]-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111525111) has the molecular formula C14H25IN4O2S and a molecular weight of 440.35 g/mol. Its IUPAC name is 1-ethyl-3-[(4-hydroxyoxan-4-yl)methyl]-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(4-hydroxyoxan-4-yl)methyl]-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111525111 |
| Molecular Formula | C14H25IN4O2S |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 1-ethyl-3-[(4-hydroxyoxan-4-yl)methyl]-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCC1(O)CCOCC1.I |
| InChI | InChI=1S/C14H24N4O2S.HI/c1-3-15-13(17-9-12-16-8-11(2)21-12)18-10-14(19)4-6-20-7-5-14;/h8,19H,3-7,9-10H2,1-2H3,(H2,15,17,18);1H |
| InChIKey | GXCVAUGSYRUBEX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|