C21H37IN4O3 — CID 111657887
1-[2-(3,5-dimethylphenoxy)ethyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111657887) has the molecular formula C21H37IN4O3 and a molecular weight of 520.46 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenoxy)ethyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dimethylphenoxy)ethyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111657887 |
| Molecular Formula | C21H37IN4O3 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 1-[2-(3,5-dimethylphenoxy)ethyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)CN1CCOCC1)NCCOc1cc(C)cc(C)c1.I |
| InChI | InChI=1S/C21H36N4O3.HI/c1-5-22-20(23-6-9-28-19-13-17(2)12-18(3)14-19)24-15-21(4,26)16-25-7-10-27-11-8-25;/h12-14,26H,5-11,15-16H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | CYQLMRLZWLMXAW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|