C22H35ClN4O2 — CID 111658428
1-[[1-(4-chlorophenyl)cyclobutyl]methyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine (PubChem CID 111658428) has the molecular formula C22H35ClN4O2 and a molecular weight of 423.00 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)cyclobutyl]methyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[[1-(4-chlorophenyl)cyclobutyl]methyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111658428 |
| Molecular Formula | C22H35ClN4O2 |
| Molecular Weight | 423.00 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)cyclobutyl]methyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)CN1CCOCC1)NCC1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C22H35ClN4O2/c1-3-24-20(25-15-21(2,28)17-27-11-13-29-14-12-27)26-16-22(9-4-10-22)18-5-7-19(23)8-6-18/h5-8,28H,3-4,9-17H2,1-2H3,(H2,24,25,26) |
| InChIKey | ZQMCHVLHUPJHBH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.00 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|