C16H17N3O3 — CID 111661251
N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(2-oxoquinoxalin-1-yl)acetamide (PubChem CID 111661251) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(2-oxoquinoxalin-1-yl)acetamide.
| Compound Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(2-oxoquinoxalin-1-yl)acetamide |
|---|---|
| PubChem CID | 111661251 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(2-oxoquinoxalin-1-yl)acetamide |
| SMILES | O=C(Cn1c(=O)cnc2ccccc21)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C16H17N3O3/c20-10-11-5-6-12(7-11)18-15(21)9-19-14-4-2-1-3-13(14)17-8-16(19)22/h1-6,8,11-12,20H,7,9-10H2,(H,18,21)/t11-,12+/m0/s1 |
| InChIKey | JIYMGJQHJADEOF-NWDGAFQWSA-N |
| XLogP | 0.45 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|