C16H18BrNO2 — CID 111661628
1-(3-bromophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]cyclopropane-1-carboxamide (PubChem CID 111661628) has the molecular formula C16H18BrNO2 and a molecular weight of 336.23 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]cyclopropane-1-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 111661628 |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 1-(3-bromophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]cyclopropane-1-carboxamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)C1(c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C16H18BrNO2/c17-13-3-1-2-12(9-13)16(6-7-16)15(20)18-14-5-4-11(8-14)10-19/h1-5,9,11,14,19H,6-8,10H2,(H,18,20)/t11-,14+/m0/s1 |
| InChIKey | ODLUMGUGNITYDF-SMDDNHRTSA-N |
| XLogP | 2.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|