C24H38N4O4 — CID 111662121
1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine (PubChem CID 111662121) has the molecular formula C24H38N4O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111662121 |
| Molecular Formula | C24H38N4O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cc(C)oc1C)NCC(c1ccc(OC)c(OC)c1)N(C)C |
| InChI | InChI=1S/C24H38N4O4/c1-9-25-23(27-15-24(4,29)19-12-16(2)32-17(19)3)26-14-20(28(5)6)18-10-11-21(30-7)22(13-18)31-8/h10-13,20,29H,9,14-15H2,1-8H3,(H2,25,26,27) |
| InChIKey | WCDGPYIBVWJINX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|