C23H35IN4O3 — CID 111663524
N-[3-[[[ethylamino-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]methylidene]amino]methyl]phenyl]-3-methylbutanamide;hydroiodide (PubChem CID 111663524) has the molecular formula C23H35IN4O3 and a molecular weight of 542.46 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]methylidene]amino]methyl]phenyl]-3-methylbutanamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]methylidene]amino]methyl]phenyl]-3-methylbutanamide;hydroiodide |
|---|---|
| PubChem CID | 111663524 |
| Molecular Formula | C23H35IN4O3 |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | N-[3-[[[ethylamino-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]methylidene]amino]methyl]phenyl]-3-methylbutanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)CC(C)C)c1)NCC(C)(O)c1ccc(C)o1.I |
| InChI | InChI=1S/C23H34N4O3.HI/c1-6-24-22(26-15-23(5,29)20-11-10-17(4)30-20)25-14-18-8-7-9-19(13-18)27-21(28)12-16(2)3;/h7-11,13,16,29H,6,12,14-15H2,1-5H3,(H,27,28)(H2,24,25,26);1H |
| InChIKey | CGJSBNISTCCFKW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|