C23H34IN5O3 — CID 111664476
N-[3-[[[ethylamino-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide (PubChem CID 111664476) has the molecular formula C23H34IN5O3 and a molecular weight of 555.46 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111664476 |
| Molecular Formula | C23H34IN5O3 |
| Molecular Weight | 555.46 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | N-[3-[[[ethylamino-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)N2CCCC2)c1)NCC(C)(O)c1ccc(C)o1.I |
| InChI | InChI=1S/C23H33N5O3.HI/c1-4-24-21(26-16-23(3,30)20-11-10-17(2)31-20)25-15-18-8-7-9-19(14-18)27-22(29)28-12-5-6-13-28;/h7-11,14,30H,4-6,12-13,15-16H2,1-3H3,(H,27,29)(H2,24,25,26);1H |
| InChIKey | VFIJRZRNRBLGBZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|