C23H34N4O3 — CID 111664187
N-tert-butyl-3-[[[ethylamino-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]methylidene]amino]methyl]benzamide (PubChem CID 111664187) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is N-tert-butyl-3-[[[ethylamino-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]methylidene]amino]methyl]benzamide.
| Compound Name | N-tert-butyl-3-[[[ethylamino-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111664187 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | N-tert-butyl-3-[[[ethylamino-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC(C)(C)C)c1)NCC(C)(O)c1ccc(C)o1 |
| InChI | InChI=1S/C23H34N4O3/c1-7-24-21(26-15-23(6,29)19-12-11-16(2)30-19)25-14-17-9-8-10-18(13-17)20(28)27-22(3,4)5/h8-13,29H,7,14-15H2,1-6H3,(H,27,28)(H2,24,25,26) |
| InChIKey | AJBWWQMZUNQNQI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|