C19H16N4O6S2 — CID 11167833
4-[[5-cyano-4-methyl-6-(4-sulfoanilino)-2-pyridinyl]amino]benzenesulfonic acid (PubChem CID 11167833) has the molecular formula C19H16N4O6S2 and a molecular weight of 460.49 g/mol. Its IUPAC name is 4-[[5-cyano-4-methyl-6-(4-sulfoanilino)-2-pyridinyl]amino]benzenesulfonic acid.
| Compound Name | 4-[[5-cyano-4-methyl-6-(4-sulfoanilino)-2-pyridinyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 11167833 |
| Molecular Formula | C19H16N4O6S2 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 4-[[5-cyano-4-methyl-6-(4-sulfoanilino)-2-pyridinyl]amino]benzenesulfonic acid |
| SMILES | Cc1cc(Nc2ccc(S(=O)(=O)O)cc2)nc(Nc2ccc(S(=O)(=O)O)cc2)c1C#N |
| InChI | InChI=1S/C19H16N4O6S2/c1-12-10-18(21-13-2-6-15(7-3-13)30(24,25)26)23-19(17(12)11-20)22-14-4-8-16(9-5-14)31(27,28)29/h2-10H,1H3,(H2,21,22,23)(H,24,25,26)(H,27,28,29) |
| InChIKey | YQJYCEVUCKFIOB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 169.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|