C19H16N4 — CID 11956691
2,6-dianilino-4-methylpyridine-3-carbonitrile (PubChem CID 11956691) has the molecular formula C19H16N4 and a molecular weight of 300.37 g/mol. Its IUPAC name is 2,6-dianilino-4-methylpyridine-3-carbonitrile.
| Compound Name | 2,6-dianilino-4-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 11956691 |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2,6-dianilino-4-methylpyridine-3-carbonitrile |
| SMILES | Cc1cc(Nc2ccccc2)nc(Nc2ccccc2)c1C#N |
| InChI | InChI=1S/C19H16N4/c1-14-12-18(21-15-8-4-2-5-9-15)23-19(17(14)13-20)22-16-10-6-3-7-11-16/h2-12H,1H3,(H2,21,22,23) |
| InChIKey | TYFMUVFYDRDOBX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |