C27H34F3N3O4 — CID 11168385
(2R)-4-morpholin-4-yl-4-oxo-2-(2-phenylethyl)-N-[(2S)-1-[4-(trifluoromethoxy)anilino]butan-2-yl]butanamide (PubChem CID 11168385) has the molecular formula C27H34F3N3O4 and a molecular weight of 521.58 g/mol. Its IUPAC name is (2R)-4-morpholin-4-yl-4-oxo-2-(2-phenylethyl)-N-[(2S)-1-[4-(trifluoromethoxy)anilino]butan-2-yl]butanamide.
| Compound Name | (2R)-4-morpholin-4-yl-4-oxo-2-(2-phenylethyl)-N-[(2S)-1-[4-(trifluoromethoxy)anilino]butan-2-yl]butanamide |
|---|---|
| PubChem CID | 11168385 |
| Molecular Formula | C27H34F3N3O4 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | (2R)-4-morpholin-4-yl-4-oxo-2-(2-phenylethyl)-N-[(2S)-1-[4-(trifluoromethoxy)anilino]butan-2-yl]butanamide |
| SMILES | CC[C@@H](CNc1ccc(OC(F)(F)F)cc1)NC(=O)[C@H](CCc1ccccc1)CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C27H34F3N3O4/c1-2-22(19-31-23-10-12-24(13-11-23)37-27(28,29)30)32-26(35)21(9-8-20-6-4-3-5-7-20)18-25(34)33-14-16-36-17-15-33/h3-7,10-13,21-22,31H,2,8-9,14-19H2,1H3,(H,32,35)/t21-,22+/m1/s1 |
| InChIKey | CHTFNMSXYMATRD-YADHBBJMSA-N |
| XLogP | 4.39 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|