C27H34F3N3O5 — CID 11203484
(2S)-2-(4-methoxyphenyl)-N-[(2S)-3-methyl-1-[4-(trifluoromethoxy)anilino]butan-2-yl]-4-morpholin-4-yl-4-oxobutanamide (PubChem CID 11203484) has the molecular formula C27H34F3N3O5 and a molecular weight of 537.58 g/mol. Its IUPAC name is (2S)-2-(4-methoxyphenyl)-N-[(2S)-3-methyl-1-[4-(trifluoromethoxy)anilino]butan-2-yl]-4-morpholin-4-yl-4-oxobutanamide.
| Compound Name | (2S)-2-(4-methoxyphenyl)-N-[(2S)-3-methyl-1-[4-(trifluoromethoxy)anilino]butan-2-yl]-4-morpholin-4-yl-4-oxobutanamide |
|---|---|
| PubChem CID | 11203484 |
| Molecular Formula | C27H34F3N3O5 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | (2S)-2-(4-methoxyphenyl)-N-[(2S)-3-methyl-1-[4-(trifluoromethoxy)anilino]butan-2-yl]-4-morpholin-4-yl-4-oxobutanamide |
| SMILES | COc1ccc([C@H](CC(=O)N2CCOCC2)C(=O)N[C@H](CNc2ccc(OC(F)(F)F)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C27H34F3N3O5/c1-18(2)24(17-31-20-6-10-22(11-7-20)38-27(28,29)30)32-26(35)23(19-4-8-21(36-3)9-5-19)16-25(34)33-12-14-37-15-13-33/h4-11,18,23-24,31H,12-17H2,1-3H3,(H,32,35)/t23-,24+/m0/s1 |
| InChIKey | FBLAHLSPEPOPEB-BJKOFHAPSA-N |
| XLogP | 4.18 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|