C32H42F3N3O4 — CID 11250282
(2R)-2-(2-cyclopentylethyl)-4-morpholin-4-yl-4-oxo-N-[(2S)-4-phenyl-1-[4-(trifluoromethoxy)anilino]butan-2-yl]butanamide (PubChem CID 11250282) has the molecular formula C32H42F3N3O4 and a molecular weight of 589.70 g/mol. Its IUPAC name is (2R)-2-(2-cyclopentylethyl)-4-morpholin-4-yl-4-oxo-N-[(2S)-4-phenyl-1-[4-(trifluoromethoxy)anilino]butan-2-yl]butanamide.
| Compound Name | (2R)-2-(2-cyclopentylethyl)-4-morpholin-4-yl-4-oxo-N-[(2S)-4-phenyl-1-[4-(trifluoromethoxy)anilino]butan-2-yl]butanamide |
|---|---|
| PubChem CID | 11250282 |
| Molecular Formula | C32H42F3N3O4 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.31 |
| IUPAC Name | (2R)-2-(2-cyclopentylethyl)-4-morpholin-4-yl-4-oxo-N-[(2S)-4-phenyl-1-[4-(trifluoromethoxy)anilino]butan-2-yl]butanamide |
| SMILES | O=C(N[C@@H](CCc1ccccc1)CNc1ccc(OC(F)(F)F)cc1)[C@H](CCC1CCCC1)CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C32H42F3N3O4/c33-32(34,35)42-29-16-14-27(15-17-29)36-23-28(13-11-25-6-2-1-3-7-25)37-31(40)26(12-10-24-8-4-5-9-24)22-30(39)38-18-20-41-21-19-38/h1-3,6-7,14-17,24,26,28,36H,4-5,8-13,18-23H2,(H,37,40)/t26-,28+/m1/s1 |
| InChIKey | UDGAOZLPEBAUEM-IAPPQJPRSA-N |
| XLogP | 5.95 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|