C13H17F3N6OS — CID 111689002
2-methyl-1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111689002) has the molecular formula C13H17F3N6OS and a molecular weight of 362.38 g/mol. Its IUPAC name is 2-methyl-1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 2-methyl-1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111689002 |
| Molecular Formula | C13H17F3N6OS |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-methyl-1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | C/N=C(\NCCc1nc(C)no1)NCCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C13H17F3N6OS/c1-8-20-10(23-22-8)3-5-18-12(17-2)19-6-4-11-21-9(7-24-11)13(14,15)16/h7H,3-6H2,1-2H3,(H2,17,18,19) |
| InChIKey | JYIFXWAAURKGBJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|