C19H22F3IN6S — CID 111689909
1-ethyl-2-[(5-phenyl-1H-imidazol-2-yl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111689909) has the molecular formula C19H22F3IN6S and a molecular weight of 550.39 g/mol. Its IUPAC name is 1-ethyl-2-[(5-phenyl-1H-imidazol-2-yl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(5-phenyl-1H-imidazol-2-yl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111689909 |
| Molecular Formula | C19H22F3IN6S |
| Molecular Weight | 550.39 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | 1-ethyl-2-[(5-phenyl-1H-imidazol-2-yl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(-c2ccccc2)[nH]1)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C19H21F3N6S.HI/c1-2-23-18(24-9-8-17-28-15(12-29-17)19(20,21)22)26-11-16-25-10-14(27-16)13-6-4-3-5-7-13;/h3-7,10,12H,2,8-9,11H2,1H3,(H,25,27)(H2,23,24,26);1H |
| InChIKey | SYIWZJCZDDGZQY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|