C17H20FNO4 — CID 111695820
5-[(4-fluorophenoxy)methyl]-N-(3-hydroxybutyl)-N-methylfuran-2-carboxamide (PubChem CID 111695820) has the molecular formula C17H20FNO4 and a molecular weight of 321.35 g/mol. Its IUPAC name is 5-[(4-fluorophenoxy)methyl]-N-(3-hydroxybutyl)-N-methylfuran-2-carboxamide.
| Compound Name | 5-[(4-fluorophenoxy)methyl]-N-(3-hydroxybutyl)-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 111695820 |
| Molecular Formula | C17H20FNO4 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 5-[(4-fluorophenoxy)methyl]-N-(3-hydroxybutyl)-N-methylfuran-2-carboxamide |
| SMILES | CC(O)CCN(C)C(=O)c1ccc(COc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C17H20FNO4/c1-12(20)9-10-19(2)17(21)16-8-7-15(23-16)11-22-14-5-3-13(18)4-6-14/h3-8,12,20H,9-11H2,1-2H3 |
| InChIKey | UDQINYVHDWWBCE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |