C17H20FNO4 — CID 111579452
5-[(4-fluorophenoxy)methyl]-N-(2-hydroxy-2-methylpropyl)-N-methylfuran-2-carboxamide (PubChem CID 111579452) has the molecular formula C17H20FNO4 and a molecular weight of 321.35 g/mol. Its IUPAC name is 5-[(4-fluorophenoxy)methyl]-N-(2-hydroxy-2-methylpropyl)-N-methylfuran-2-carboxamide.
| Compound Name | 5-[(4-fluorophenoxy)methyl]-N-(2-hydroxy-2-methylpropyl)-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 111579452 |
| Molecular Formula | C17H20FNO4 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 5-[(4-fluorophenoxy)methyl]-N-(2-hydroxy-2-methylpropyl)-N-methylfuran-2-carboxamide |
| SMILES | CN(CC(C)(C)O)C(=O)c1ccc(COc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C17H20FNO4/c1-17(2,21)11-19(3)16(20)15-9-8-14(23-15)10-22-13-6-4-12(18)5-7-13/h4-9,21H,10-11H2,1-3H3 |
| InChIKey | KVKFGSOSPJYMOU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |