C20H17BrFNO3 — CID 31215377
N-[(2-bromophenyl)methyl]-5-[(4-fluorophenoxy)methyl]-N-methylfuran-2-carboxamide (PubChem CID 31215377) has the molecular formula C20H17BrFNO3 and a molecular weight of 418.26 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-5-[(4-fluorophenoxy)methyl]-N-methylfuran-2-carboxamide.
| Compound Name | N-[(2-bromophenyl)methyl]-5-[(4-fluorophenoxy)methyl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 31215377 |
| Molecular Formula | C20H17BrFNO3 |
| Molecular Weight | 418.26 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-5-[(4-fluorophenoxy)methyl]-N-methylfuran-2-carboxamide |
| SMILES | CN(Cc1ccccc1Br)C(=O)c1ccc(COc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C20H17BrFNO3/c1-23(12-14-4-2-3-5-18(14)21)20(24)19-11-10-17(26-19)13-25-16-8-6-15(22)7-9-16/h2-11H,12-13H2,1H3 |
| InChIKey | YYQIYUHQUDSWDO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.26 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |