C18H21FN2O3 — CID 111696915
3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]propanamide (PubChem CID 111696915) has the molecular formula C18H21FN2O3 and a molecular weight of 332.38 g/mol. Its IUPAC name is 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]propanamide.
| Compound Name | 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]propanamide |
|---|---|
| PubChem CID | 111696915 |
| Molecular Formula | C18H21FN2O3 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]propanamide |
| SMILES | O=C(CCN1C(=O)CCc2cc(F)ccc21)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C18H21FN2O3/c19-14-3-5-16-13(10-14)2-6-18(24)21(16)8-7-17(23)20-15-4-1-12(9-15)11-22/h1,3-5,10,12,15,22H,2,6-9,11H2,(H,20,23)/t12-,15+/m0/s1 |
| InChIKey | UJVLACPSXODHSR-SWLSCSKDSA-N |
| XLogP | 1.55 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|