C18H23N3O3 — CID 111697297
4-cyano-N-[2-(2-hydroxyethyl)pentyl]-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide (PubChem CID 111697297) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-cyano-N-[2-(2-hydroxyethyl)pentyl]-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide.
| Compound Name | 4-cyano-N-[2-(2-hydroxyethyl)pentyl]-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide |
|---|---|
| PubChem CID | 111697297 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 4-cyano-N-[2-(2-hydroxyethyl)pentyl]-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide |
| SMILES | CCCC(CCO)CNC(=O)c1c(C)oc(-n2cccc2)c1C#N |
| InChI | InChI=1S/C18H23N3O3/c1-3-6-14(7-10-22)12-20-17(23)16-13(2)24-18(15(16)11-19)21-8-4-5-9-21/h4-5,8-9,14,22H,3,6-7,10,12H2,1-2H3,(H,20,23) |
| InChIKey | AOCDTVFTCUIBDO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|