C20H30N2O3 — CID 111697394
1-(3,5-dimethylphenyl)-N-[2-(2-hydroxyethyl)pentyl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 111697394) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-N-[2-(2-hydroxyethyl)pentyl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3,5-dimethylphenyl)-N-[2-(2-hydroxyethyl)pentyl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 111697394 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-N-[2-(2-hydroxyethyl)pentyl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | CCCC(CCO)CNC(=O)C1CCN(c2cc(C)cc(C)c2)C1=O |
| InChI | InChI=1S/C20H30N2O3/c1-4-5-16(7-9-23)13-21-19(24)18-6-8-22(20(18)25)17-11-14(2)10-15(3)12-17/h10-12,16,18,23H,4-9,13H2,1-3H3,(H,21,24) |
| InChIKey | NBZWEUAJFSHPMN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|