C20H29IN4O2S — CID 111704864
N-[5-[[[ethylamino-(2-thiophen-3-ylpropylamino)methylidene]amino]methyl]-2-methoxyphenyl]acetamide;hydroiodide (PubChem CID 111704864) has the molecular formula C20H29IN4O2S and a molecular weight of 516.45 g/mol. Its IUPAC name is N-[5-[[[ethylamino-(2-thiophen-3-ylpropylamino)methylidene]amino]methyl]-2-methoxyphenyl]acetamide;hydroiodide.
| Compound Name | N-[5-[[[ethylamino-(2-thiophen-3-ylpropylamino)methylidene]amino]methyl]-2-methoxyphenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111704864 |
| Molecular Formula | C20H29IN4O2S |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | N-[5-[[[ethylamino-(2-thiophen-3-ylpropylamino)methylidene]amino]methyl]-2-methoxyphenyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(NC(C)=O)c1)NCC(C)c1ccsc1.I |
| InChI | InChI=1S/C20H28N4O2S.HI/c1-5-21-20(22-11-14(2)17-8-9-27-13-17)23-12-16-6-7-19(26-4)18(10-16)24-15(3)25;/h6-10,13-14H,5,11-12H2,1-4H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | PDXCBUUVJYTMIQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|