C16H26IN7O2S — CID 111706274
1-ethyl-2-[[3-(methylsulfamoylmethyl)phenyl]methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111706274) has the molecular formula C16H26IN7O2S and a molecular weight of 507.40 g/mol. Its IUPAC name is 1-ethyl-2-[[3-(methylsulfamoylmethyl)phenyl]methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[3-(methylsulfamoylmethyl)phenyl]methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111706274 |
| Molecular Formula | C16H26IN7O2S |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | 1-ethyl-2-[[3-(methylsulfamoylmethyl)phenyl]methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(CS(=O)(=O)NC)c1)NCc1ncnn1C.I |
| InChI | InChI=1S/C16H25N7O2S.HI/c1-4-18-16(20-10-15-21-12-22-23(15)3)19-9-13-6-5-7-14(8-13)11-26(24,25)17-2;/h5-8,12,17H,4,9-11H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | RYGKDIXJOSKPJQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|