C19H28IN7O2 — CID 111705360
N-[3-[[[ethylamino-[(2-methyl-1,2,4-triazol-3-yl)methylamino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide (PubChem CID 111705360) has the molecular formula C19H28IN7O2 and a molecular weight of 513.38 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[(2-methyl-1,2,4-triazol-3-yl)methylamino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[(2-methyl-1,2,4-triazol-3-yl)methylamino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111705360 |
| Molecular Formula | C19H28IN7O2 |
| Molecular Weight | 513.38 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | N-[3-[[[ethylamino-[(2-methyl-1,2,4-triazol-3-yl)methylamino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCCO2)c1)NCc1ncnn1C.I |
| InChI | InChI=1S/C19H27N7O2.HI/c1-3-20-19(22-12-17-23-13-24-26(17)2)21-11-14-6-4-7-15(10-14)25-18(27)16-8-5-9-28-16;/h4,6-7,10,13,16H,3,5,8-9,11-12H2,1-2H3,(H,25,27)(H2,20,21,22);1H |
| InChIKey | ADKZQDUHJSLQFR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|