About tert-butyl 1H-pyrrole-3-carboxylate
tert-butyl 1H-pyrrole-3-carboxylate (PubChem CID 11171190) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is tert-butyl 1H-pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 1H-pyrrole-3-carboxylate |
| PubChem CID | 11171190 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | tert-butyl 1H-pyrrole-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C9H13NO2/c1-9(2,3)12-8(11)7-4-5-10-6-7/h4-6,10H,1-3H3 |
| InChIKey | GSQXBOPBINCMTF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl 1H-pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 1H-pyrrole-3-carboxylate?
The IUPAC name of tert-butyl 1H-pyrrole-3-carboxylate (CID 11171190) is tert-butyl 1H-pyrrole-3-carboxylate.
What is the SMILES notation for tert-butyl 1H-pyrrole-3-carboxylate?
The canonical SMILES for tert-butyl 1H-pyrrole-3-carboxylate is CC(C)(C)OC(=O)c1cc[nH]c1.
What is the InChIKey of tert-butyl 1H-pyrrole-3-carboxylate?
The InChIKey is GSQXBOPBINCMTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-9(2,3)12-8(11)7-4-5-10-6-7/h4-6,10H,1-3H3.
What are the key properties of tert-butyl 1H-pyrrole-3-carboxylate?
tert-butyl 1H-pyrrole-3-carboxylate has a molecular weight of 167.21 g/mol, XLogP of 1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1H-pyrrole-3-carboxylate is sourced from PubChem (CID 11171190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).