About 1H-pyrrole-3-carboxylic acid;hydrate
1H-pyrrole-3-carboxylic acid;hydrate (PubChem CID 45076181) has the molecular formula C5H7NO3
and a molecular weight of 129.11 g/mol. Its IUPAC name is 1H-pyrrole-3-carboxylic acid;hydrate.
Molecular Properties
| Compound Name | 1H-pyrrole-3-carboxylic acid;hydrate |
| PubChem CID | 45076181 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | 1H-pyrrole-3-carboxylic acid;hydrate |
| SMILES | O.O=C(O)c1cc[nH]c1 |
| InChI | InChI=1S/C5H5NO2.H2O/c7-5(8)4-1-2-6-3-4;/h1-3,6H,(H,7,8);1H2 |
| InChIKey | CFVUWWPGGBWCTB-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-pyrrole-3-carboxylic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrole-3-carboxylic acid;hydrate?
The IUPAC name of 1H-pyrrole-3-carboxylic acid;hydrate (CID 45076181) is 1H-pyrrole-3-carboxylic acid;hydrate.
What is the SMILES notation for 1H-pyrrole-3-carboxylic acid;hydrate?
The canonical SMILES for 1H-pyrrole-3-carboxylic acid;hydrate is O.O=C(O)c1cc[nH]c1.
What is the InChIKey of 1H-pyrrole-3-carboxylic acid;hydrate?
The InChIKey is CFVUWWPGGBWCTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2.H2O/c7-5(8)4-1-2-6-3-4;/h1-3,6H,(H,7,8);1H2.
What are the key properties of 1H-pyrrole-3-carboxylic acid;hydrate?
1H-pyrrole-3-carboxylic acid;hydrate has a molecular weight of 129.11 g/mol, XLogP of -0.11, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrole-3-carboxylic acid;hydrate is sourced from PubChem (CID 45076181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).