C22H35FIN5O — CID 111715960
1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111715960) has the molecular formula C22H35FIN5O and a molecular weight of 531.46 g/mol. Its IUPAC name is 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111715960 |
| Molecular Formula | C22H35FIN5O |
| Molecular Weight | 531.46 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2C)c(F)c1)NCC(CC)(CC)CCO.I |
| InChI | InChI=1S/C22H34FN5O.HI/c1-5-22(6-2,10-13-29)16-27-21(24-7-3)26-15-18-8-9-20(19(23)14-18)28-12-11-25-17(28)4;/h8-9,11-12,14,29H,5-7,10,13,15-16H2,1-4H3,(H2,24,26,27);1H |
| InChIKey | XWUWLECXRNQAMT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|