C21H26FN5OS — CID 111654804
1-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine (PubChem CID 111654804) has the molecular formula C21H26FN5OS and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine.
| Compound Name | 1-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111654804 |
| Molecular Formula | C21H26FN5OS |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 1-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2C)c(F)c1)NCC(C)(O)c1ccsc1 |
| InChI | InChI=1S/C21H26FN5OS/c1-4-23-20(26-14-21(3,28)17-7-10-29-13-17)25-12-16-5-6-19(18(22)11-16)27-9-8-24-15(27)2/h5-11,13,28H,4,12,14H2,1-3H3,(H2,23,25,26) |
| InChIKey | RKOSZFKIWDCUEL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|